75885-58-4
| Name | (S)-(+)-2,2-Dimethylcyclopropanecarboxamide |
| CAS | 75885-58-4 |
| EINECS(EC#) | 278-334-3 |
| Molecular Formula | C6H11NO |
| MDL Number | MFCD00216614 |
| Molecular Weight | 113.16 |
| MOL File | 75885-58-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 135-137 °C (lit.) |
| alpha | 82 º (c=1, MeOH) |
| Boiling point | 203 - 204 |
| density | 1g/cm |
| refractive index | 83 ° (C=1, MeOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol |
| form | Crystalline Powder |
| pka | 16.61±0.40(Predicted) |
| color | White to Off-white |
| Optical Rotation | [α]20/D +82°, c = 1 in methanol |
| InChI | InChI=1S/C6H11NO/c1-6(2)3-4(6)5(7)8/h4H,3H2,1-2H3,(H2,7,8)/t4-/m1/s1 |
| InChIKey | YBZQRYWKYBZZNT-SCSAIBSYSA-N |
| SMILES | [C@H]1(C(N)=O)CC1(C)C |
| CAS DataBase Reference | 75885-58-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |